C29H50N2O6Si2 — CID 151443096
[(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylidenepyrrolidin-1-yl]-[5-methoxy-2-nitro-4-tri(propan-2-yl)silyloxyphenyl]methanone (PubChem CID 151443096) has the molecular formula C29H50N2O6Si2 and a molecular weight of 578.90 g/mol. Its IUPAC name is [(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylidenepyrrolidin-1-yl]-[5-methoxy-2-nitro-4-tri(propan-2-yl)silyloxyphenyl]methanone.
| Compound Name | [(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylidenepyrrolidin-1-yl]-[5-methoxy-2-nitro-4-tri(propan-2-yl)silyloxyphenyl]methanone |
|---|---|
| PubChem CID | 151443096 |
| Molecular Formula | C29H50N2O6Si2 |
| Molecular Weight | 578.90 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | [(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylidenepyrrolidin-1-yl]-[5-methoxy-2-nitro-4-tri(propan-2-yl)silyloxyphenyl]methanone |
| SMILES | C=C1C[C@@H](CO[Si](C)(C)C(C)(C)C)N(C(=O)c2cc(OC)c(O[Si](C(C)C)(C(C)C)C(C)C)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C29H50N2O6Si2/c1-19(2)39(20(3)4,21(5)6)37-27-16-25(31(33)34)24(15-26(27)35-11)28(32)30-17-22(7)14-23(30)18-36-38(12,13)29(8,9)10/h15-16,19-21,23H,7,14,17-18H2,1-6,8-13H3/t23-/m0/s1 |
| InChIKey | PEXZUUASUONJJF-QHCPKHFHSA-N |
| XLogP | 7.95 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.90 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|