C23H38N2O7Si — CID 164715949
[(2S,4R)-4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]-[5-methoxy-2-nitro-4-tri(propan-2-yl)silyloxyphenyl]methanone (PubChem CID 164715949) has the molecular formula C23H38N2O7Si and a molecular weight of 482.65 g/mol. Its IUPAC name is [(2S,4R)-4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]-[5-methoxy-2-nitro-4-tri(propan-2-yl)silyloxyphenyl]methanone.
| Compound Name | [(2S,4R)-4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]-[5-methoxy-2-nitro-4-tri(propan-2-yl)silyloxyphenyl]methanone |
|---|---|
| PubChem CID | 164715949 |
| Molecular Formula | C23H38N2O7Si |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | [(2S,4R)-4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]-[5-methoxy-2-nitro-4-tri(propan-2-yl)silyloxyphenyl]methanone |
| SMILES | COc1cc(C(=O)N2CC[C@@H](O)C[C@H]2CO)c([N+](=O)[O-])cc1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H38N2O7Si/c1-14(2)33(15(3)4,16(5)6)32-22-12-20(25(29)30)19(11-21(22)31-7)23(28)24-9-8-18(27)10-17(24)13-26/h11-12,14-18,26-27H,8-10,13H2,1-7H3/t17-,18+/m0/s1 |
| InChIKey | YAUARPKBGBBAJE-ZWKOTPCHSA-N |
| XLogP | 4.12 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|