C21H32N2O6Si — CID 157243365
(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(5-methoxy-4-methyl-2-nitrobenzoyl)piperidin-4-one (PubChem CID 157243365) has the molecular formula C21H32N2O6Si and a molecular weight of 436.58 g/mol. Its IUPAC name is (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(5-methoxy-4-methyl-2-nitrobenzoyl)piperidin-4-one.
| Compound Name | (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(5-methoxy-4-methyl-2-nitrobenzoyl)piperidin-4-one |
|---|---|
| PubChem CID | 157243365 |
| Molecular Formula | C21H32N2O6Si |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(5-methoxy-4-methyl-2-nitrobenzoyl)piperidin-4-one |
| SMILES | COc1cc(C(=O)N2CCC(=O)C[C@H]2CO[Si](C)(C)C(C)(C)C)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C21H32N2O6Si/c1-14-10-18(23(26)27)17(12-19(14)28-5)20(25)22-9-8-16(24)11-15(22)13-29-30(6,7)21(2,3)4/h10,12,15H,8-9,11,13H2,1-7H3/t15-/m0/s1 |
| InChIKey | XUKLOHWFYLPFKJ-HNNXBMFYSA-N |
| XLogP | 4.11 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|