C31H37FN4O7S — CID 91119596
[(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[4-[3-[6-(4-fluorophenyl)-2-methylpyrimidin-4-yl]oxypropoxy]-5-methoxy-2-nitrophenyl]methanone (PubChem CID 91119596) has the molecular formula C31H37FN4O7S and a molecular weight of 628.72 g/mol. Its IUPAC name is [(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[4-[3-[6-(4-fluorophenyl)-2-methylpyrimidin-4-yl]oxypropoxy]-5-methoxy-2-nitrophenyl]methanone.
| Compound Name | [(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[4-[3-[6-(4-fluorophenyl)-2-methylpyrimidin-4-yl]oxypropoxy]-5-methoxy-2-nitrophenyl]methanone |
|---|---|
| PubChem CID | 91119596 |
| Molecular Formula | C31H37FN4O7S |
| Molecular Weight | 628.72 g/mol |
| Exact Mass | 628.24 |
| IUPAC Name | [(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[4-[3-[6-(4-fluorophenyl)-2-methylpyrimidin-4-yl]oxypropoxy]-5-methoxy-2-nitrophenyl]methanone |
| SMILES | CCOC(SCC)[C@@H]1CCCN1C(=O)c1cc(OC)c(OCCCOc2cc(-c3ccc(F)cc3)nc(C)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H37FN4O7S/c1-5-41-31(44-6-2)25-9-7-14-35(25)30(37)23-17-27(40-4)28(19-26(23)36(38)39)42-15-8-16-43-29-18-24(33-20(3)34-29)21-10-12-22(32)13-11-21/h10-13,17-19,25,31H,5-9,14-16H2,1-4H3/t25-,31?/m0/s1 |
| InChIKey | OJFPYGOCZNKONA-ZGAORZAOSA-N |
| XLogP | 6.08 |
| TPSA | 126.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.72 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|