C33H41FN4O7S — CID 91032650
[(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[3-[4-[6-(4-fluorophenyl)-2-methylpyrimidin-4-yl]oxypentoxy]-5-methoxy-2-nitrophenyl]methanone (PubChem CID 91032650) has the molecular formula C33H41FN4O7S and a molecular weight of 656.78 g/mol. Its IUPAC name is [(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[3-[4-[6-(4-fluorophenyl)-2-methylpyrimidin-4-yl]oxypentoxy]-5-methoxy-2-nitrophenyl]methanone.
| Compound Name | [(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[3-[4-[6-(4-fluorophenyl)-2-methylpyrimidin-4-yl]oxypentoxy]-5-methoxy-2-nitrophenyl]methanone |
|---|---|
| PubChem CID | 91032650 |
| Molecular Formula | C33H41FN4O7S |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | [(2S)-2-[ethoxy(ethylsulfanyl)methyl]pyrrolidin-1-yl]-[3-[4-[6-(4-fluorophenyl)-2-methylpyrimidin-4-yl]oxypentoxy]-5-methoxy-2-nitrophenyl]methanone |
| SMILES | CCOC(SCC)[C@@H]1CCCN1C(=O)c1cc(OC)cc(OCCCC(C)Oc2cc(-c3ccc(F)cc3)nc(C)n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C33H41FN4O7S/c1-6-43-33(46-7-2)28-11-8-16-37(28)32(39)26-18-25(42-5)19-29(31(26)38(40)41)44-17-9-10-21(3)45-30-20-27(35-22(4)36-30)23-12-14-24(34)15-13-23/h12-15,18-21,28,33H,6-11,16-17H2,1-5H3/t21?,28-,33?/m0/s1 |
| InChIKey | YNAOFQZMVCAAMW-SODKLWTISA-N |
| XLogP | 6.85 |
| TPSA | 126.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|