C11H17NO3 — CID 166848927
methyl 5-carbamoyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate (PubChem CID 166848927) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is methyl 5-carbamoyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate.
| Compound Name | methyl 5-carbamoyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate |
|---|---|
| PubChem CID | 166848927 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | methyl 5-carbamoyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate |
| SMILES | COC(=O)C1CC2CC(C(N)=O)CC2C1 |
| InChI | InChI=1S/C11H17NO3/c1-15-11(14)9-4-6-2-8(10(12)13)3-7(6)5-9/h6-9H,2-5H2,1H3,(H2,12,13) |
| InChIKey | YVPHLBZCBLNXPX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |