C10H15BrO4 — CID 101131037
methyl (1R,3R,4S)-3-acetyloxy-4-bromocyclohexane-1-carboxylate (PubChem CID 101131037) has the molecular formula C10H15BrO4 and a molecular weight of 279.13 g/mol. Its IUPAC name is methyl (1R,3R,4S)-3-acetyloxy-4-bromocyclohexane-1-carboxylate.
| Compound Name | methyl (1R,3R,4S)-3-acetyloxy-4-bromocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 101131037 |
| Molecular Formula | C10H15BrO4 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | methyl (1R,3R,4S)-3-acetyloxy-4-bromocyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@H](Br)[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C10H15BrO4/c1-6(12)15-9-5-7(10(13)14-2)3-4-8(9)11/h7-9H,3-5H2,1-2H3/t7-,8+,9-/m1/s1 |
| InChIKey | LNOMXPUCLDHIQE-HRDYMLBCSA-N |
| XLogP | 1.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|