C8H13BrO3 — CID 101131035
methyl (1S,3S,4R)-4-bromo-3-hydroxycyclohexane-1-carboxylate (PubChem CID 101131035) has the molecular formula C8H13BrO3 and a molecular weight of 237.09 g/mol. Its IUPAC name is methyl (1S,3S,4R)-4-bromo-3-hydroxycyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3S,4R)-4-bromo-3-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 101131035 |
| Molecular Formula | C8H13BrO3 |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | methyl (1S,3S,4R)-4-bromo-3-hydroxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC[C@@H](Br)[C@@H](O)C1 |
| InChI | InChI=1S/C8H13BrO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h5-7,10H,2-4H2,1H3/t5-,6+,7-/m0/s1 |
| InChIKey | SQOUCOUCDZRJKH-XVMARJQXSA-N |
| XLogP | 1.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|