C9H16O8S2 — CID 58822152
trans-methyl (3S,4S)-3,4-bis(methylsulfonyloxy)cyclopentane-1-carboxylate (PubChem CID 58822152) has the molecular formula C9H16O8S2 and a molecular weight of 316.35 g/mol. Its IUPAC name is trans-methyl (3S,4S)-3,4-bis(methylsulfonyloxy)cyclopentane-1-carboxylate.
| Compound Name | trans-methyl (3S,4S)-3,4-bis(methylsulfonyloxy)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 58822152 |
| Molecular Formula | C9H16O8S2 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | trans-methyl (3S,4S)-3,4-bis(methylsulfonyloxy)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1C[C@H](OS(C)(=O)=O)[C@@H](OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C9H16O8S2/c1-15-9(10)6-4-7(16-18(2,11)12)8(5-6)17-19(3,13)14/h6-8H,4-5H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | ZCUKZPHTJHYICF-YUMQZZPRSA-N |
| XLogP | -0.74 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|