C27H38O6SSi — CID 11642109
methyl (1S,3R,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-ethyl-5-methylsulfonyloxycyclohexane-1-carboxylate (PubChem CID 11642109) has the molecular formula C27H38O6SSi and a molecular weight of 518.75 g/mol. Its IUPAC name is methyl (1S,3R,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-ethyl-5-methylsulfonyloxycyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3R,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-ethyl-5-methylsulfonyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11642109 |
| Molecular Formula | C27H38O6SSi |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | methyl (1S,3R,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-ethyl-5-methylsulfonyloxycyclohexane-1-carboxylate |
| SMILES | CC[C@@H]1[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H](C(=O)OC)C[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C27H38O6SSi/c1-7-23-24(32-34(6,29)30)18-20(26(28)31-5)19-25(23)33-35(27(2,3)4,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17,20,23-25H,7,18-19H2,1-6H3/t20-,23+,24-,25-/m1/s1 |
| InChIKey | CLBZGIBELCKMSP-HKTJVKLFSA-N |
| XLogP | 3.89 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|