C30H38O4SSi — CID 140824530
[(1S,3S,4S)-3-benzyl-4-[tert-butyl(diphenyl)silyl]oxycyclohexyl] methanesulfonate (PubChem CID 140824530) has the molecular formula C30H38O4SSi and a molecular weight of 522.78 g/mol. Its IUPAC name is [(1S,3S,4S)-3-benzyl-4-[tert-butyl(diphenyl)silyl]oxycyclohexyl] methanesulfonate.
| Compound Name | [(1S,3S,4S)-3-benzyl-4-[tert-butyl(diphenyl)silyl]oxycyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 140824530 |
| Molecular Formula | C30H38O4SSi |
| Molecular Weight | 522.78 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | [(1S,3S,4S)-3-benzyl-4-[tert-butyl(diphenyl)silyl]oxycyclohexyl] methanesulfonate |
| SMILES | CC(C)(C)[Si](O[C@H]1CC[C@H](OS(C)(=O)=O)C[C@@H]1Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H38O4SSi/c1-30(2,3)36(27-16-10-6-11-17-27,28-18-12-7-13-19-28)34-29-21-20-26(33-35(4,31)32)23-25(29)22-24-14-8-5-9-15-24/h5-19,25-26,29H,20-23H2,1-4H3/t25-,26-,29-/m0/s1 |
| InChIKey | IWLDUJQFLCSUTF-ZEZDXWPOSA-N |
| XLogP | 5.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.78 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|