C29H37NO2Si — CID 10837631
[(1R,2R,3R)-2-(benzylamino)-3-[tert-butyl(diphenyl)silyl]oxycyclopentyl]methanol (PubChem CID 10837631) has the molecular formula C29H37NO2Si and a molecular weight of 459.71 g/mol. Its IUPAC name is [(1R,2R,3R)-2-(benzylamino)-3-[tert-butyl(diphenyl)silyl]oxycyclopentyl]methanol.
| Compound Name | [(1R,2R,3R)-2-(benzylamino)-3-[tert-butyl(diphenyl)silyl]oxycyclopentyl]methanol |
|---|---|
| PubChem CID | 10837631 |
| Molecular Formula | C29H37NO2Si |
| Molecular Weight | 459.71 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | [(1R,2R,3R)-2-(benzylamino)-3-[tert-butyl(diphenyl)silyl]oxycyclopentyl]methanol |
| SMILES | CC(C)(C)[Si](O[C@@H]1CC[C@@H](CO)[C@H]1NCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H37NO2Si/c1-29(2,3)33(25-15-9-5-10-16-25,26-17-11-6-12-18-26)32-27-20-19-24(22-31)28(27)30-21-23-13-7-4-8-14-23/h4-18,24,27-28,30-31H,19-22H2,1-3H3/t24-,27+,28+/m0/s1 |
| InChIKey | YSFYSZQKTFSQJQ-HNPKZYAISA-N |
| XLogP | 4.49 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.71 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|