C27H33NOSi — CID 174429442
[(3R)-5-benzylpyrrolidin-3-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 174429442) has the molecular formula C27H33NOSi and a molecular weight of 415.65 g/mol. Its IUPAC name is [(3R)-5-benzylpyrrolidin-3-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(3R)-5-benzylpyrrolidin-3-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 174429442 |
| Molecular Formula | C27H33NOSi |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | [(3R)-5-benzylpyrrolidin-3-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](O[C@H]1CNC(Cc2ccccc2)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33NOSi/c1-27(2,3)30(25-15-9-5-10-16-25,26-17-11-6-12-18-26)29-24-20-23(28-21-24)19-22-13-7-4-8-14-22/h4-18,23-24,28H,19-21H2,1-3H3/t23?,24-/m1/s1 |
| InChIKey | HGNQJOILILTACZ-XMMISQBUSA-N |
| XLogP | 4.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|