C28H33NO3Si — CID 174143265
2-[[(2R,4R)-4-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-yl]methyl]benzoic acid (PubChem CID 174143265) has the molecular formula C28H33NO3Si and a molecular weight of 459.66 g/mol. Its IUPAC name is 2-[[(2R,4R)-4-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-yl]methyl]benzoic acid.
| Compound Name | 2-[[(2R,4R)-4-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 174143265 |
| Molecular Formula | C28H33NO3Si |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2-[[(2R,4R)-4-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-yl]methyl]benzoic acid |
| SMILES | CC(C)(C)[Si](O[C@H]1CN[C@H](Cc2ccccc2C(=O)O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO3Si/c1-28(2,3)33(24-13-6-4-7-14-24,25-15-8-5-9-16-25)32-23-19-22(29-20-23)18-21-12-10-11-17-26(21)27(30)31/h4-17,22-23,29H,18-20H2,1-3H3,(H,30,31)/t22-,23-/m1/s1 |
| InChIKey | VKFIEILQEQHQLW-DHIUTWEWSA-N |
| XLogP | 4.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|