C29H34BrNO3Si — CID 101247392
methyl (2S)-2-(4-bromophenyl)-2-[(2R,4S)-4-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-yl]acetate (PubChem CID 101247392) has the molecular formula C29H34BrNO3Si and a molecular weight of 552.59 g/mol. Its IUPAC name is methyl (2S)-2-(4-bromophenyl)-2-[(2R,4S)-4-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-yl]acetate.
| Compound Name | methyl (2S)-2-(4-bromophenyl)-2-[(2R,4S)-4-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 101247392 |
| Molecular Formula | C29H34BrNO3Si |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | methyl (2S)-2-(4-bromophenyl)-2-[(2R,4S)-4-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-yl]acetate |
| SMILES | COC(=O)[C@@H](c1ccc(Br)cc1)[C@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CN1 |
| InChI | InChI=1S/C29H34BrNO3Si/c1-29(2,3)35(24-11-7-5-8-12-24,25-13-9-6-10-14-25)34-23-19-26(31-20-23)27(28(32)33-4)21-15-17-22(30)18-16-21/h5-18,23,26-27,31H,19-20H2,1-4H3/t23-,26+,27-/m0/s1 |
| InChIKey | YLTZAVCHBAJQOX-RNJDCESWSA-N |
| XLogP | 5.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|