C33H39N3O2SSi — CID 171817186
(2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide (PubChem CID 171817186) has the molecular formula C33H39N3O2SSi and a molecular weight of 569.85 g/mol. Its IUPAC name is (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 171817186 |
| Molecular Formula | C33H39N3O2SSi |
| Molecular Weight | 569.85 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ncsc1-c1ccc([C@H](C)NC(=O)[C@@H]2C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CN2)cc1 |
| InChI | InChI=1S/C33H39N3O2SSi/c1-23(25-16-18-26(19-17-25)31-24(2)35-22-39-31)36-32(37)30-20-27(21-34-30)38-40(33(3,4)5,28-12-8-6-9-13-28)29-14-10-7-11-15-29/h6-19,22-23,27,30,34H,20-21H2,1-5H3,(H,36,37)/t23-,27+,30-/m0/s1 |
| InChIKey | FSLCUIMTWAFCQJ-JBXWGSRRSA-N |
| XLogP | 5.60 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.85 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|