C22H29N7O2S — CID 170349708
(2S,4R)-4-(5-azidopentanoylamino)-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide (PubChem CID 170349708) has the molecular formula C22H29N7O2S and a molecular weight of 455.59 g/mol. Its IUPAC name is (2S,4R)-4-(5-azidopentanoylamino)-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-(5-azidopentanoylamino)-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170349708 |
| Molecular Formula | C22H29N7O2S |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (2S,4R)-4-(5-azidopentanoylamino)-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ncsc1-c1ccc(C(C)NC(=O)[C@@H]2C[C@@H](NC(=O)CCCCN=[N+]=[N-])CN2)cc1 |
| InChI | InChI=1S/C22H29N7O2S/c1-14(16-6-8-17(9-7-16)21-15(2)25-13-32-21)27-22(31)19-11-18(12-24-19)28-20(30)5-3-4-10-26-29-23/h6-9,13-14,18-19,24H,3-5,10-12H2,1-2H3,(H,27,31)(H,28,30)/t14?,18-,19+/m1/s1 |
| InChIKey | IRLWLORFVUAQPE-BRQZFJGMSA-N |
| XLogP | 3.62 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|