C28H40N8O3S — CID 175813496
1-[(2S)-2-amino-3,3-dimethylbutanoyl]-4-(5-azidopentanoylamino)-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide (PubChem CID 175813496) has the molecular formula C28H40N8O3S and a molecular weight of 568.75 g/mol. Its IUPAC name is 1-[(2S)-2-amino-3,3-dimethylbutanoyl]-4-(5-azidopentanoylamino)-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[(2S)-2-amino-3,3-dimethylbutanoyl]-4-(5-azidopentanoylamino)-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 175813496 |
| Molecular Formula | C28H40N8O3S |
| Molecular Weight | 568.75 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 1-[(2S)-2-amino-3,3-dimethylbutanoyl]-4-(5-azidopentanoylamino)-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ncsc1-c1ccc([C@H](C)NC(=O)C2CC(NC(=O)CCCCN=[N+]=[N-])CN2C(=O)[C@@H](N)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H40N8O3S/c1-17(19-9-11-20(12-10-19)24-18(2)31-16-40-24)33-26(38)22-14-21(34-23(37)8-6-7-13-32-35-30)15-36(22)27(39)25(29)28(3,4)5/h9-12,16-17,21-22,25H,6-8,13-15,29H2,1-5H3,(H,33,38)(H,34,37)/t17-,21?,22?,25+/m0/s1 |
| InChIKey | ZMBJUHOBGFMGMW-RXWOYSAWSA-N |
| XLogP | 4.24 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.75 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|