C27H40N2O3Si — CID 69334111
tert-butyl 2-[tert-butyl(diphenyl)silyl]oxy-2-[(2S,4R)-4-(methylamino)pyrrolidin-2-yl]acetate (PubChem CID 69334111) has the molecular formula C27H40N2O3Si and a molecular weight of 468.71 g/mol. Its IUPAC name is tert-butyl 2-[tert-butyl(diphenyl)silyl]oxy-2-[(2S,4R)-4-(methylamino)pyrrolidin-2-yl]acetate.
| Compound Name | tert-butyl 2-[tert-butyl(diphenyl)silyl]oxy-2-[(2S,4R)-4-(methylamino)pyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 69334111 |
| Molecular Formula | C27H40N2O3Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | tert-butyl 2-[tert-butyl(diphenyl)silyl]oxy-2-[(2S,4R)-4-(methylamino)pyrrolidin-2-yl]acetate |
| SMILES | CN[C@H]1CN[C@H](C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C27H40N2O3Si/c1-26(2,3)31-25(30)24(23-18-20(28-7)19-29-23)32-33(27(4,5)6,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17,20,23-24,28-29H,18-19H2,1-7H3/t20-,23+,24?/m1/s1 |
| InChIKey | KEPXGBRGLQSEIQ-FQCAPJHASA-N |
| XLogP | 3.22 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|