C30H44O6Si2 — CID 46899489
methyl (2S)-2-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyacetate (PubChem CID 46899489) has the molecular formula C30H44O6Si2 and a molecular weight of 556.85 g/mol. Its IUPAC name is methyl (2S)-2-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyacetate.
| Compound Name | methyl (2S)-2-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyacetate |
|---|---|
| PubChem CID | 46899489 |
| Molecular Formula | C30H44O6Si2 |
| Molecular Weight | 556.85 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | methyl (2S)-2-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyacetate |
| SMILES | COC(=O)[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C30H44O6Si2/c1-29(2,3)37(8,9)35-22-20-25(34-26(31)21-22)27(28(32)33-7)36-38(30(4,5)6,23-16-12-10-13-17-23)24-18-14-11-15-19-24/h10-19,22,25,27H,20-21H2,1-9H3/t22-,25+,27-/m0/s1 |
| InChIKey | UOBJIAWAAMIZEA-RWUBSVTLSA-N |
| XLogP | 5.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.85 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|