C25H34O5Si — CID 70677506
(2S)-2-[tert-butyl(diphenyl)silyl]oxy-2-[(2R,4R,6R)-4,6-dimethoxyoxan-2-yl]acetaldehyde (PubChem CID 70677506) has the molecular formula C25H34O5Si and a molecular weight of 442.63 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(diphenyl)silyl]oxy-2-[(2R,4R,6R)-4,6-dimethoxyoxan-2-yl]acetaldehyde.
| Compound Name | (2S)-2-[tert-butyl(diphenyl)silyl]oxy-2-[(2R,4R,6R)-4,6-dimethoxyoxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 70677506 |
| Molecular Formula | C25H34O5Si |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | (2S)-2-[tert-butyl(diphenyl)silyl]oxy-2-[(2R,4R,6R)-4,6-dimethoxyoxan-2-yl]acetaldehyde |
| SMILES | CO[C@H]1C[C@H](OC)O[C@@H]([C@@H](C=O)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C25H34O5Si/c1-25(2,3)31(20-12-8-6-9-13-20,21-14-10-7-11-15-21)30-23(18-26)22-16-19(27-4)17-24(28-5)29-22/h6-15,18-19,22-24H,16-17H2,1-5H3/t19-,22-,23-,24-/m1/s1 |
| InChIKey | CZMXEFCYGONFLO-OTUUDDROSA-N |
| XLogP | 3.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|