C34H42O5SSi — CID 15953223
methyl (E,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(2R,4R,6S)-4-methoxy-6-phenylsulfanyloxan-2-yl]-2-methylbut-2-enoate (PubChem CID 15953223) has the molecular formula C34H42O5SSi and a molecular weight of 590.86 g/mol. Its IUPAC name is methyl (E,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(2R,4R,6S)-4-methoxy-6-phenylsulfanyloxan-2-yl]-2-methylbut-2-enoate.
| Compound Name | methyl (E,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(2R,4R,6S)-4-methoxy-6-phenylsulfanyloxan-2-yl]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 15953223 |
| Molecular Formula | C34H42O5SSi |
| Molecular Weight | 590.86 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | methyl (E,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(2R,4R,6S)-4-methoxy-6-phenylsulfanyloxan-2-yl]-2-methylbut-2-enoate |
| SMILES | COC(=O)/C(C)=C/[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1C[C@@H](OC)C[C@H](Sc2ccccc2)O1 |
| InChI | InChI=1S/C34H42O5SSi/c1-25(33(35)37-6)22-31(30-23-26(36-5)24-32(38-30)40-27-16-10-7-11-17-27)39-41(34(2,3)4,28-18-12-8-13-19-28)29-20-14-9-15-21-29/h7-22,26,30-32H,23-24H2,1-6H3/b25-22+/t26-,30-,31-,32+/m1/s1 |
| InChIKey | PQAOAHPJGIXFRP-FJKXRDFQSA-N |
| XLogP | 6.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.86 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|