C24H34O5Si — CID 171124063
(2R,4R,6R)-6-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-hydroxyethyl]-4-methoxyoxan-2-ol (PubChem CID 171124063) has the molecular formula C24H34O5Si and a molecular weight of 430.62 g/mol. Its IUPAC name is (2R,4R,6R)-6-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-hydroxyethyl]-4-methoxyoxan-2-ol.
| Compound Name | (2R,4R,6R)-6-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-hydroxyethyl]-4-methoxyoxan-2-ol |
|---|---|
| PubChem CID | 171124063 |
| Molecular Formula | C24H34O5Si |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (2R,4R,6R)-6-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-hydroxyethyl]-4-methoxyoxan-2-ol |
| SMILES | CO[C@H]1C[C@H](O)O[C@@H]([C@@H](CO)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C24H34O5Si/c1-24(2,3)30(19-11-7-5-8-12-19,20-13-9-6-10-14-20)29-22(17-25)21-15-18(27-4)16-23(26)28-21/h5-14,18,21-23,25-26H,15-17H2,1-4H3/t18-,21-,22-,23-/m1/s1 |
| InChIKey | JUQZQGAULUHMAM-RLLPEYFOSA-N |
| XLogP | 2.44 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|