C31H44O5Si — CID 102251169
tert-butyl (E)-4-[(3S,5R)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-2-hydroxyoxolan-3-yl]but-2-enoate (PubChem CID 102251169) has the molecular formula C31H44O5Si and a molecular weight of 524.77 g/mol. Its IUPAC name is tert-butyl (E)-4-[(3S,5R)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-2-hydroxyoxolan-3-yl]but-2-enoate.
| Compound Name | tert-butyl (E)-4-[(3S,5R)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-2-hydroxyoxolan-3-yl]but-2-enoate |
|---|---|
| PubChem CID | 102251169 |
| Molecular Formula | C31H44O5Si |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | tert-butyl (E)-4-[(3S,5R)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-2-hydroxyoxolan-3-yl]but-2-enoate |
| SMILES | CC[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1C[C@H](C/C=C/C(=O)OC(C)(C)C)C(O)O1 |
| InChI | InChI=1S/C31H44O5Si/c1-8-26(27-22-23(29(33)34-27)16-15-21-28(32)35-30(2,3)4)36-37(31(5,6)7,24-17-11-9-12-18-24)25-19-13-10-14-20-25/h9-15,17-21,23,26-27,29,33H,8,16,22H2,1-7H3/b21-15+/t23-,26+,27+,29?/m0/s1 |
| InChIKey | CCFOCCYTPMABAQ-QMIFGCMQSA-N |
| XLogP | 5.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|