C30H44O3Si2 — CID 11145634
methyl (2E,6S,7Z)-6-[tert-butyl(diphenyl)silyl]oxy-10-trimethylsilyldeca-2,7-dienoate (PubChem CID 11145634) has the molecular formula C30H44O3Si2 and a molecular weight of 508.85 g/mol. Its IUPAC name is methyl (2E,6S,7Z)-6-[tert-butyl(diphenyl)silyl]oxy-10-trimethylsilyldeca-2,7-dienoate.
| Compound Name | methyl (2E,6S,7Z)-6-[tert-butyl(diphenyl)silyl]oxy-10-trimethylsilyldeca-2,7-dienoate |
|---|---|
| PubChem CID | 11145634 |
| Molecular Formula | C30H44O3Si2 |
| Molecular Weight | 508.85 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | methyl (2E,6S,7Z)-6-[tert-butyl(diphenyl)silyl]oxy-10-trimethylsilyldeca-2,7-dienoate |
| SMILES | COC(=O)/C=C/CC[C@@H](/C=C\CC[Si](C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H44O3Si2/c1-30(2,3)35(27-20-10-8-11-21-27,28-22-12-9-13-23-28)33-26(18-14-15-24-29(31)32-4)19-16-17-25-34(5,6)7/h8-13,15-16,19-24,26H,14,17-18,25H2,1-7H3/b19-16-,24-15+/t26-/m0/s1 |
| InChIKey | XJXYWOFVKAYRBE-BAQTWNNPSA-N |
| XLogP | 6.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.85 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|