C26H36O3Si — CID 71484241
[(2S,4R)-4-[(E,1R)-1-[tert-butyl(diphenyl)silyl]oxyhex-3-enyl]oxetan-2-yl]methanol (PubChem CID 71484241) has the molecular formula C26H36O3Si and a molecular weight of 424.66 g/mol. Its IUPAC name is [(2S,4R)-4-[(E,1R)-1-[tert-butyl(diphenyl)silyl]oxyhex-3-enyl]oxetan-2-yl]methanol.
| Compound Name | [(2S,4R)-4-[(E,1R)-1-[tert-butyl(diphenyl)silyl]oxyhex-3-enyl]oxetan-2-yl]methanol |
|---|---|
| PubChem CID | 71484241 |
| Molecular Formula | C26H36O3Si |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [(2S,4R)-4-[(E,1R)-1-[tert-butyl(diphenyl)silyl]oxyhex-3-enyl]oxetan-2-yl]methanol |
| SMILES | CC/C=C/C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1C[C@@H](CO)O1 |
| InChI | InChI=1S/C26H36O3Si/c1-5-6-9-18-24(25-19-21(20-27)28-25)29-30(26(2,3)4,22-14-10-7-11-15-22)23-16-12-8-13-17-23/h6-17,21,24-25,27H,5,18-20H2,1-4H3/b9-6+/t21-,24+,25+/m0/s1 |
| InChIKey | FQVYNEZJEGYWNP-VYGPEONOSA-N |
| XLogP | 4.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|