C43H56O5Si2 — CID 10974553
tert-butyl (3R)-3-[tert-butyl(diphenyl)silyl]oxy-3-[(2S,3R)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxiran-2-yl]propanoate (PubChem CID 10974553) has the molecular formula C43H56O5Si2 and a molecular weight of 709.09 g/mol. Its IUPAC name is tert-butyl (3R)-3-[tert-butyl(diphenyl)silyl]oxy-3-[(2S,3R)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxiran-2-yl]propanoate.
| Compound Name | tert-butyl (3R)-3-[tert-butyl(diphenyl)silyl]oxy-3-[(2S,3R)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxiran-2-yl]propanoate |
|---|---|
| PubChem CID | 10974553 |
| Molecular Formula | C43H56O5Si2 |
| Molecular Weight | 709.09 g/mol |
| Exact Mass | 708.37 |
| IUPAC Name | tert-butyl (3R)-3-[tert-butyl(diphenyl)silyl]oxy-3-[(2S,3R)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxiran-2-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1O[C@@H]1CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C43H56O5Si2/c1-41(2,3)47-39(44)32-38(48-50(43(7,8)9,35-26-18-12-19-27-35)36-28-20-13-21-29-36)40-37(46-40)30-31-45-49(42(4,5)6,33-22-14-10-15-23-33)34-24-16-11-17-25-34/h10-29,37-38,40H,30-32H2,1-9H3/t37-,38-,40+/m1/s1 |
| InChIKey | JQZJWCANBNACJD-GGQMZCENSA-N |
| XLogP | 7.40 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.09 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|