C34H54O5Si2 — CID 11028378
tert-butyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]propanoate (PubChem CID 11028378) has the molecular formula C34H54O5Si2 and a molecular weight of 598.97 g/mol. Its IUPAC name is tert-butyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]propanoate.
| Compound Name | tert-butyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]propanoate |
|---|---|
| PubChem CID | 11028378 |
| Molecular Formula | C34H54O5Si2 |
| Molecular Weight | 598.97 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | tert-butyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H54O5Si2/c1-32(2,3)38-30(35)25-29(39-40(10,11)33(4,5)6)31-28(37-31)23-18-24-36-41(34(7,8)9,26-19-14-12-15-20-26)27-21-16-13-17-22-27/h12-17,19-22,28-29,31H,18,23-25H2,1-11H3/t28-,29+,31-/m1/s1 |
| InChIKey | DLLJOYLIPGLNGG-ATNBEAFSSA-N |
| XLogP | 7.23 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.97 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|