C30H37NO4Si — CID 10994736
[(2S,3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]methyl N-benzylcarbamate (PubChem CID 10994736) has the molecular formula C30H37NO4Si and a molecular weight of 503.72 g/mol. Its IUPAC name is [(2S,3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]methyl N-benzylcarbamate.
| Compound Name | [(2S,3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]methyl N-benzylcarbamate |
|---|---|
| PubChem CID | 10994736 |
| Molecular Formula | C30H37NO4Si |
| Molecular Weight | 503.72 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | [(2S,3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]methyl N-benzylcarbamate |
| SMILES | CC(C)(C)[Si](OCCC[C@H]1O[C@H]1COC(=O)NCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H37NO4Si/c1-30(2,3)36(25-16-9-5-10-17-25,26-18-11-6-12-19-26)34-21-13-20-27-28(35-27)23-33-29(32)31-22-24-14-7-4-8-15-24/h4-12,14-19,27-28H,13,20-23H2,1-3H3,(H,31,32)/t27-,28+/m1/s1 |
| InChIKey | AQJPXXKQMXAUMA-IZLXSDGUSA-N |
| XLogP | 5.04 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.72 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|