C32H42O9Si — CID 11585199
[(E,4R)-4-[(3aR,4R,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl] acetate (PubChem CID 11585199) has the molecular formula C32H42O9Si and a molecular weight of 598.77 g/mol. Its IUPAC name is [(E,4R)-4-[(3aR,4R,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl] acetate.
| Compound Name | [(E,4R)-4-[(3aR,4R,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl] acetate |
|---|---|
| PubChem CID | 11585199 |
| Molecular Formula | C32H42O9Si |
| Molecular Weight | 598.77 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | [(E,4R)-4-[(3aR,4R,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl] acetate |
| SMILES | CO[C@@H]1O[C@H]([C@@H](/C=C/C(OC(C)=O)OC(C)=O)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C32H42O9Si/c1-21(33)36-26(37-22(2)34)20-19-25(27-28-29(30(35-8)38-27)40-32(6,7)39-28)41-42(31(3,4)5,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-20,25-30H,1-8H3/b20-19+/t25-,27-,28-,29-,30-/m1/s1 |
| InChIKey | YZUBNZIKTQIWCW-JMIOQYGMSA-N |
| XLogP | 3.83 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|