C12H20O6 — CID 101003937
(4R)-4-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-hydroxybutan-2-one (PubChem CID 101003937) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (4R)-4-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-hydroxybutan-2-one.
| Compound Name | (4R)-4-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-hydroxybutan-2-one |
|---|---|
| PubChem CID | 101003937 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (4R)-4-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-hydroxybutan-2-one |
| SMILES | CO[C@@H]1O[C@H]([C@H](O)CC(C)=O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H20O6/c1-6(13)5-7(14)8-9-10(11(15-4)16-8)18-12(2,3)17-9/h7-11,14H,5H2,1-4H3/t7-,8-,9-,10-,11-/m1/s1 |
| InChIKey | HVZPHMADJOAQSO-ISUQUUIWSA-N |
| XLogP | 0.22 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |