C14H24O7 — CID 172641810
[(4R,6R,6aR)-6-(1,2-dihydroxyethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] pentanoate (PubChem CID 172641810) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is [(4R,6R,6aR)-6-(1,2-dihydroxyethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] pentanoate.
| Compound Name | [(4R,6R,6aR)-6-(1,2-dihydroxyethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] pentanoate |
|---|---|
| PubChem CID | 172641810 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | [(4R,6R,6aR)-6-(1,2-dihydroxyethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@H]1O[C@H](C(O)CO)[C@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C14H24O7/c1-4-5-6-9(17)18-13-12-11(20-14(2,3)21-12)10(19-13)8(16)7-15/h8,10-13,15-16H,4-7H2,1-3H3/t8?,10-,11-,12?,13+/m1/s1 |
| InChIKey | GBOXGZJXWIPQOH-KNYHMHNZSA-N |
| XLogP | 0.32 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |