C13H23NO7 — CID 20759889
ethyl 2-amino-3-hydroxy-3-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)propanoate (PubChem CID 20759889) has the molecular formula C13H23NO7 and a molecular weight of 305.33 g/mol. Its IUPAC name is ethyl 2-amino-3-hydroxy-3-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)propanoate.
| Compound Name | ethyl 2-amino-3-hydroxy-3-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)propanoate |
|---|---|
| PubChem CID | 20759889 |
| Molecular Formula | C13H23NO7 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | ethyl 2-amino-3-hydroxy-3-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)propanoate |
| SMILES | CCOC(=O)C(N)C(O)C1OC(OC)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C13H23NO7/c1-5-18-11(16)6(14)7(15)8-9-10(12(17-4)19-8)21-13(2,3)20-9/h6-10,12,15H,5,14H2,1-4H3 |
| InChIKey | KMHIKOQNLHCIOF-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |