C15H27O8P — CID 164998267
ethyl 2-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-dimethylphosphorylacetate (PubChem CID 164998267) has the molecular formula C15H27O8P and a molecular weight of 366.35 g/mol. Its IUPAC name is ethyl 2-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-dimethylphosphorylacetate.
| Compound Name | ethyl 2-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-dimethylphosphorylacetate |
|---|---|
| PubChem CID | 164998267 |
| Molecular Formula | C15H27O8P |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | ethyl 2-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-dimethylphosphorylacetate |
| SMILES | CCOC(=O)C(OC[C@H]1O[C@@H](OC)[C@@H]2OC(C)(C)O[C@@H]21)P(C)(C)=O |
| InChI | InChI=1S/C15H27O8P/c1-7-19-12(16)14(24(5,6)17)20-8-9-10-11(13(18-4)21-9)23-15(2,3)22-10/h9-11,13-14H,7-8H2,1-6H3/t9-,10-,11-,13-,14?/m1/s1 |
| InChIKey | VRASXIPUJPXBNG-SYALQFACSA-N |
| XLogP | 1.41 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|