C12H18O6 — CID 58942936
(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methyl prop-2-enoate (PubChem CID 58942936) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is (4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methyl prop-2-enoate.
| Compound Name | (4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 58942936 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1OC(OC)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C12H18O6/c1-5-8(13)15-6-7-9-10(11(14-4)16-7)18-12(2,3)17-9/h5,7,9-11H,1,6H2,2-4H3 |
| InChIKey | RHOWHPLKHCIPOZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|