C13H25O7P — CID 11110123
(3aR,4R,6S,6aS)-6-(diethoxyphosphorylmethyl)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 11110123) has the molecular formula C13H25O7P and a molecular weight of 324.31 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-6-(diethoxyphosphorylmethyl)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aR,4R,6S,6aS)-6-(diethoxyphosphorylmethyl)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 11110123 |
| Molecular Formula | C13H25O7P |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (3aR,4R,6S,6aS)-6-(diethoxyphosphorylmethyl)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CCOP(=O)(C[C@H]1O[C@@H](OC)[C@@H]2OC(C)(C)O[C@@H]21)OCC |
| InChI | InChI=1S/C13H25O7P/c1-6-16-21(14,17-7-2)8-9-10-11(12(15-5)18-9)20-13(3,4)19-10/h9-12H,6-8H2,1-5H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | NBDYFOXYPMXJQA-DDHJBXDOSA-N |
| XLogP | 2.14 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|