C10H18NaO6P — CID 101178419
sodium 2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl-dioxidophosphanium (PubChem CID 101178419) has the molecular formula C10H18NaO6P and a molecular weight of 288.21 g/mol. Its IUPAC name is sodium 2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl-dioxidophosphanium.
| Compound Name | sodium 2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl-dioxidophosphanium |
|---|---|
| PubChem CID | 101178419 |
| Molecular Formula | C10H18NaO6P |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | sodium 2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl-dioxidophosphanium |
| SMILES | CO[C@@H]1O[C@H](CC[PH+]([O-])[O-])[C@H]2OC(C)(C)O[C@@H]12.[Na+] |
| InChI | InChI=1S/C10H18O6P.Na/c1-10(2)15-7-6(4-5-17(11)12)14-9(13-3)8(7)16-10;/h6-9,17H,4-5H2,1-3H3;/q-1;+1/t6-,7-,8-,9-;/m1./s1 |
| InChIKey | XPACTWAHIBIBGI-SHJDMIRESA-N |
| XLogP | -3.96 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | -3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|