C21H43NO15P2S — CID 161276143
CID 161276143 (PubChem CID 161276143) has the molecular formula C21H43NO15P2S and a molecular weight of 643.58 g/mol.
| Compound Name | CID 161276143 |
|---|---|
| PubChem CID | 161276143 |
| Molecular Formula | C21H43NO15P2S |
| Molecular Weight | 643.58 g/mol |
| Exact Mass | 643.18 |
| IUPAC Name | — |
| SMILES | CCOP(C)(=O)CC[C@H]1OC(O)[C@H](O)[C@@H]1O.CO[C@@H]1O[C@H](CCP(C)(C)=O)[C@H]2OC(C)(C)O[C@@H]12.O=NS(=O)OO |
| InChI | InChI=1S/C12H23O5P.C9H19O6P.HNO4S/c1-12(2)16-9-8(6-7-18(4,5)13)15-11(14-3)10(9)17-12;1-3-14-16(2,13)5-4-6-7(10)8(11)9(12)15-6;2-1-6(4)5-3/h8-11H,6-7H2,1-5H3;6-12H,3-5H2,1-2H3;3H/t8-,9-,10-,11-;6-,7-,8-,9?,16?;/m11./s1 |
| InChIKey | VELSGNGFRUHWIG-OCTXAQJPSA-N |
| XLogP | 1.47 |
| TPSA | 226.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.58 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|