About CID 161276143
CID 161276143 (PubChem CID 161276143) has the molecular formula C21H43NO15P2S
and a molecular weight of 643.58 g/mol.
Molecular Properties
| Compound Name | CID 161276143 |
| PubChem CID | 161276143 |
| Molecular Formula | C21H43NO15P2S |
| Molecular Weight | 643.58 g/mol |
| Exact Mass | 643.18 |
| IUPAC Name | — |
| SMILES | CCOP(C)(=O)CC[C@H]1OC(O)[C@H](O)[C@@H]1O.CO[C@@H]1O[C@H](CCP(C)(C)=O)[C@H]2OC(C)(C)O[C@@H]12.O=NS(=O)OO |
| InChI | InChI=1S/C12H23O5P.C9H19O6P.HNO4S/c1-12(2)16-9-8(6-7-18(4,5)13)15-11(14-3)10(9)17-12;1-3-14-16(2,13)5-4-6-7(10)8(11)9(12)15-6;2-1-6(4)5-3/h8-11H,6-7H2,1-5H3;6-12H,3-5H2,1-2H3;3H/t8-,9-,10-,11-;6-,7-,8-,9?,16?;/m11./s1 |
| InChIKey | VELSGNGFRUHWIG-OCTXAQJPSA-N |
| XLogP | 1.47 |
| TPSA | 226.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 643.58 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 161276143 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161276143?
The IUPAC name of CID 161276143 (CID 161276143) is not available.
What is the SMILES notation for CID 161276143?
The canonical SMILES for CID 161276143 is CCOP(C)(=O)CC[C@H]1OC(O)[C@H](O)[C@@H]1O.CO[C@@H]1O[C@H](CCP(C)(C)=O)[C@H]2OC(C)(C)O[C@@H]12.O=NS(=O)OO.
What is the InChIKey of CID 161276143?
The InChIKey is VELSGNGFRUHWIG-OCTXAQJPSA-N. The full InChI is InChI=1S/C12H23O5P.C9H19O6P.HNO4S/c1-12(2)16-9-8(6-7-18(4,5)13)15-11(14-3)10(9)17-12;1-3-14-16(2,13)5-4-6-7(10)8(11)9(12)15-6;2-1-6(4)5-3/h8-11H,6-7H2,1-5H3;6-12H,3-5H2,1-2H3;3H/t8-,9-,10-,11-;6-,7-,8-,9?,16?;/m11./s1.
What are the key properties of CID 161276143?
CID 161276143 has a molecular weight of 643.58 g/mol, XLogP of 1.47, 11 rotatable bonds, 4 hydrogen bond donors, and 15 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161276143 is sourced from PubChem (CID 161276143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).