C41H50O6Si2 — CID 11072519
(2R)-2-[tert-butyl(diphenyl)silyl]oxy-2-[(4S,5S)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-oxoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde (PubChem CID 11072519) has the molecular formula C41H50O6Si2 and a molecular weight of 695.02 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(diphenyl)silyl]oxy-2-[(4S,5S)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-oxoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde.
| Compound Name | (2R)-2-[tert-butyl(diphenyl)silyl]oxy-2-[(4S,5S)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-oxoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 11072519 |
| Molecular Formula | C41H50O6Si2 |
| Molecular Weight | 695.02 g/mol |
| Exact Mass | 694.31 |
| IUPAC Name | (2R)-2-[tert-butyl(diphenyl)silyl]oxy-2-[(4S,5S)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxy-2-oxoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
| SMILES | CC1(C)O[C@H]([C@H](C=O)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]([C@H](C=O)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C41H50O6Si2/c1-39(2,3)48(31-21-13-9-14-22-31,32-23-15-10-16-24-32)46-35(29-42)37-38(45-41(7,8)44-37)36(30-43)47-49(40(4,5)6,33-25-17-11-18-26-33)34-27-19-12-20-28-34/h9-30,35-38H,1-8H3/t35-,36-,37+,38+/m0/s1 |
| InChIKey | FQYJKFIGMJJSDM-CDBYGCFJSA-N |
| XLogP | 5.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.02 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|