C27H36O5Si — CID 11626914
(2S)-2-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyacetaldehyde (PubChem CID 11626914) has the molecular formula C27H36O5Si and a molecular weight of 468.67 g/mol. Its IUPAC name is (2S)-2-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyacetaldehyde.
| Compound Name | (2S)-2-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyacetaldehyde |
|---|---|
| PubChem CID | 11626914 |
| Molecular Formula | C27H36O5Si |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (2S)-2-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyacetaldehyde |
| SMILES | C=C[C@@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O[C@H]1[C@@H](C=O)OC |
| InChI | InChI=1S/C27H36O5Si/c1-8-27(24(23(19-28)29-7)31-26(5,6)32-27)20-30-33(25(2,3)4,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h8-19,23-24H,1,20H2,2-7H3/t23-,24+,27+/m1/s1 |
| InChIKey | XLYGZJWRHVWZEZ-DXBVXKBHSA-N |
| XLogP | 3.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|