C24H32O4Si — CID 99772772
(2S,3R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-2-methoxyoxolan-3-ol (PubChem CID 99772772) has the molecular formula C24H32O4Si and a molecular weight of 412.60 g/mol. Its IUPAC name is (2S,3R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-2-methoxyoxolan-3-ol.
| Compound Name | (2S,3R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-2-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 99772772 |
| Molecular Formula | C24H32O4Si |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2S,3R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-2-methoxyoxolan-3-ol |
| SMILES | C=C[C@@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H](O)[C@@H](OC)O1 |
| InChI | InChI=1S/C24H32O4Si/c1-6-24(17-21(25)22(26-5)28-24)18-27-29(23(2,3)4,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h6-16,21-22,25H,1,17-18H2,2-5H3/t21-,22+,24+/m1/s1 |
| InChIKey | METGBWGAFHFPKK-GPXNEJASSA-N |
| XLogP | 3.24 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|