C30H40O3Si — CID 101179874
4-[(4R,5R)-4,5-bis(ethenyl)-2-prop-2-enyl-1,3-dioxolan-2-yl]butoxy-tert-butyl-diphenylsilane (PubChem CID 101179874) has the molecular formula C30H40O3Si and a molecular weight of 476.73 g/mol. Its IUPAC name is 4-[(4R,5R)-4,5-bis(ethenyl)-2-prop-2-enyl-1,3-dioxolan-2-yl]butoxy-tert-butyl-diphenylsilane.
| Compound Name | 4-[(4R,5R)-4,5-bis(ethenyl)-2-prop-2-enyl-1,3-dioxolan-2-yl]butoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 101179874 |
| Molecular Formula | C30H40O3Si |
| Molecular Weight | 476.73 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 4-[(4R,5R)-4,5-bis(ethenyl)-2-prop-2-enyl-1,3-dioxolan-2-yl]butoxy-tert-butyl-diphenylsilane |
| SMILES | C=CCC1(CCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H](C=C)[C@@H](C=C)O1 |
| InChI | InChI=1S/C30H40O3Si/c1-7-22-30(32-27(8-2)28(9-3)33-30)23-16-17-24-31-34(29(4,5)6,25-18-12-10-13-19-25)26-20-14-11-15-21-26/h7-15,18-21,27-28H,1-3,16-17,22-24H2,4-6H3/t27-,28-/m1/s1 |
| InChIKey | NOGYPPIFBNFBRH-VSGBNLITSA-N |
| XLogP | 6.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.73 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|