C25H31BF2O4Si — CID 59483239
CID 59483239 (PubChem CID 59483239) has the molecular formula C25H31BF2O4Si and a molecular weight of 472.41 g/mol.
| Compound Name | CID 59483239 |
|---|---|
| PubChem CID | 59483239 |
| Molecular Formula | C25H31BF2O4Si |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@](CC=C(F)F)(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OC)[C@H]1O |
| InChI | InChI=1S/C25H31BF2O4Si/c1-24(2,3)33(18-11-7-5-8-12-18,19-13-9-6-10-14-19)31-17-25(16-15-20(27)28)22(30-4)21(29)23(26)32-25/h5-15,21-23,29H,16-17H2,1-4H3/t21-,22+,23-,25-/m1/s1 |
| InChIKey | JTNLHUOHMHXHPJ-STAYPELNSA-N |
| XLogP | 3.37 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|