C26H35BO3Si — CID 59483029
CID 59483029 (PubChem CID 59483029) has the molecular formula C26H35BO3Si and a molecular weight of 434.46 g/mol.
| Compound Name | CID 59483029 |
|---|---|
| PubChem CID | 59483029 |
| Molecular Formula | C26H35BO3Si |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@@]2(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC(C)(C)[C@@H]1[C@@H]2OC |
| InChI | InChI=1S/C26H35BO3Si/c1-24(2,3)31(19-13-9-7-10-14-19,20-15-11-8-12-16-20)29-18-26-17-25(4,5)21(22(26)28-6)23(27)30-26/h7-16,21-23H,17-18H2,1-6H3/t21-,22+,23-,26-/m1/s1 |
| InChIKey | TWXYMZVOGVJWDC-ZGXDEKTJSA-N |
| XLogP | 3.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|