C24H31O2SiU- — CID 59483014
CID 59483014 (PubChem CID 59483014) has the molecular formula C24H31O2SiU- and a molecular weight of 617.63 g/mol.
| Compound Name | CID 59483014 |
|---|---|
| PubChem CID | 59483014 |
| Molecular Formula | C24H31O2SiU- |
| Molecular Weight | 617.63 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | — |
| SMILES | CC1C2[CH-]OC1(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC2.[U] |
| InChI | InChI=1S/C24H31O2Si.U/c1-19-20-15-16-24(19,25-17-20)18-26-27(23(2,3)4,21-11-7-5-8-12-21)22-13-9-6-10-14-22;/h5-14,17,19-20H,15-16,18H2,1-4H3;/q-1; |
| InChIKey | MFLANZUOCFRKRG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|