C27H35O6SiU- — CID 59509737
[(3R,4S,5R)-3-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-3,4-dihydro-2H-furan-2-id-5-yl]methyl acetate;uranium (PubChem CID 59509737) has the molecular formula C27H35O6SiU- and a molecular weight of 721.69 g/mol. Its IUPAC name is [(3R,4S,5R)-3-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-3,4-dihydro-2H-furan-2-id-5-yl]methyl acetate;uranium.
| Compound Name | [(3R,4S,5R)-3-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-3,4-dihydro-2H-furan-2-id-5-yl]methyl acetate;uranium |
|---|---|
| PubChem CID | 59509737 |
| Molecular Formula | C27H35O6SiU- |
| Molecular Weight | 721.69 g/mol |
| Exact Mass | 721.27 |
| IUPAC Name | [(3R,4S,5R)-3-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-3,4-dihydro-2H-furan-2-id-5-yl]methyl acetate;uranium |
| SMILES | CC(=O)OC[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[CH-][C@H](OC(C)=O)[C@@H]1C.[U] |
| InChI | InChI=1S/C27H35O6Si.U/c1-20-25(33-22(3)29)17-31-27(20,18-30-21(2)28)19-32-34(26(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24;/h7-17,20,25H,18-19H2,1-6H3;/q-1;/t20-,25-,27+;/m0./s1 |
| InChIKey | ZVQNPWUVKNHPCU-JDMHGGSLSA-N |
| XLogP | 3.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.69 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|