C26H32O5Si — CID 67024439
methyl (1R,2R)-2-acetyloxy-1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopent-3-ene-1-carboxylate (PubChem CID 67024439) has the molecular formula C26H32O5Si and a molecular weight of 452.62 g/mol. Its IUPAC name is methyl (1R,2R)-2-acetyloxy-1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopent-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2R)-2-acetyloxy-1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 67024439 |
| Molecular Formula | C26H32O5Si |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | methyl (1R,2R)-2-acetyloxy-1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopent-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H32O5Si/c1-20(27)31-23-17-12-18-26(23,24(28)29-5)19-30-32(25(2,3)4,21-13-8-6-9-14-21)22-15-10-7-11-16-22/h6-17,23H,18-19H2,1-5H3/t23-,26-/m1/s1 |
| InChIKey | GSAHIHWKTOPREH-ZEQKJWHPSA-N |
| XLogP | 3.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|