C23H30NO4SiU- — CID 59509655
CID 59509655 (PubChem CID 59509655) has the molecular formula C23H30NO4SiU- and a molecular weight of 650.61 g/mol.
| Compound Name | CID 59509655 |
|---|---|
| PubChem CID | 59509655 |
| Molecular Formula | C23H30NO4SiU- |
| Molecular Weight | 650.61 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | — |
| SMILES | CON1C[C@]2(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O[CH-][C@H]1[C@@H]2O.[U] |
| InChI | InChI=1S/C23H30NO4Si.U/c1-22(2,3)29(18-11-7-5-8-12-18,19-13-9-6-10-14-19)28-17-23-16-24(26-4)20(15-27-23)21(23)25;/h5-15,20-21,25H,16-17H2,1-4H3;/q-1;/t20-,21-,23+;/m0./s1 |
| InChIKey | UQGXQLOOLQNESE-XVGZVFJZSA-N |
| XLogP | 2.10 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.61 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|