C31H48O5Si — CID 11734142
[(4R,5S)-5-[(2S)-butan-2-yl]-4-(diethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 11734142) has the molecular formula C31H48O5Si and a molecular weight of 528.81 g/mol. Its IUPAC name is [(4R,5S)-5-[(2S)-butan-2-yl]-4-(diethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(4R,5S)-5-[(2S)-butan-2-yl]-4-(diethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11734142 |
| Molecular Formula | C31H48O5Si |
| Molecular Weight | 528.81 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | [(4R,5S)-5-[(2S)-butan-2-yl]-4-(diethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CCOC(OCC)[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O[C@H]1[C@@H](C)CC |
| InChI | InChI=1S/C31H48O5Si/c1-10-24(4)27-31(36-30(8,9)35-27,28(32-11-2)33-12-3)23-34-37(29(5,6)7,25-19-15-13-16-20-25)26-21-17-14-18-22-26/h13-22,24,27-28H,10-12,23H2,1-9H3/t24-,27-,31+/m0/s1 |
| InChIKey | DTWFCANAVLWXGP-PPGHQKADSA-N |
| XLogP | 5.90 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.81 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|