C41H50ClNO6Si2 — CID 100914587
[(3aS,5S,6R,6aR)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-chloro-2,2-dimethyl-6-nitroso-5,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 100914587) has the molecular formula C41H50ClNO6Si2 and a molecular weight of 744.48 g/mol. Its IUPAC name is [(3aS,5S,6R,6aR)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-chloro-2,2-dimethyl-6-nitroso-5,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aS,5S,6R,6aR)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-chloro-2,2-dimethyl-6-nitroso-5,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 100914587 |
| Molecular Formula | C41H50ClNO6Si2 |
| Molecular Weight | 744.48 g/mol |
| Exact Mass | 743.29 |
| IUPAC Name | [(3aS,5S,6R,6aR)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-chloro-2,2-dimethyl-6-nitroso-5,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@@H]2[C@@](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)(O[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@]2(Cl)N=O)O1 |
| InChI | InChI=1S/C41H50ClNO6Si2/c1-37(2,3)50(31-21-13-9-14-22-31,32-23-15-10-16-24-32)45-29-35-41(42,43-44)36-40(47-35,49-39(7,8)48-36)30-46-51(38(4,5)6,33-25-17-11-18-26-33)34-27-19-12-20-28-34/h9-28,35-36H,29-30H2,1-8H3/t35-,36+,40-,41-/m0/s1 |
| InChIKey | PYWBBRPVNJRWQI-QFMXGDCESA-N |
| XLogP | 7.09 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.48 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|